C19H27Cl3N2O2 — CID 17055788
N-[[4-[(6-chloro-3-pyridinyl)methoxy]-3-ethoxyphenyl]methyl]-2-methylpropan-2-amine;dihydrochloride (PubChem CID 17055788) has the molecular formula C19H27Cl3N2O2 and a molecular weight of 421.80 g/mol. Its IUPAC name is N-[[4-[(6-chloro-3-pyridinyl)methoxy]-3-ethoxyphenyl]methyl]-2-methylpropan-2-amine;dihydrochloride.
| Compound Name | N-[[4-[(6-chloro-3-pyridinyl)methoxy]-3-ethoxyphenyl]methyl]-2-methylpropan-2-amine;dihydrochloride |
|---|---|
| PubChem CID | 17055788 |
| Molecular Formula | C19H27Cl3N2O2 |
| Molecular Weight | 421.80 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | N-[[4-[(6-chloro-3-pyridinyl)methoxy]-3-ethoxyphenyl]methyl]-2-methylpropan-2-amine;dihydrochloride |
| SMILES | CCOc1cc(CNC(C)(C)C)ccc1OCc1ccc(Cl)nc1.Cl.Cl |
| InChI | InChI=1S/C19H25ClN2O2.2ClH/c1-5-23-17-10-14(12-22-19(2,3)4)6-8-16(17)24-13-15-7-9-18(20)21-11-15;;/h6-11,22H,5,12-13H2,1-4H3;2*1H |
| InChIKey | CXQOAKMYPIXOCS-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.80 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|