C23H27Cl3N2O2 — CID 17055804
N-[[4-[(6-chloro-3-pyridinyl)methoxy]-3-ethoxyphenyl]methyl]-1-phenylethanamine;dihydrochloride (PubChem CID 17055804) has the molecular formula C23H27Cl3N2O2 and a molecular weight of 469.84 g/mol. Its IUPAC name is N-[[4-[(6-chloro-3-pyridinyl)methoxy]-3-ethoxyphenyl]methyl]-1-phenylethanamine;dihydrochloride.
| Compound Name | N-[[4-[(6-chloro-3-pyridinyl)methoxy]-3-ethoxyphenyl]methyl]-1-phenylethanamine;dihydrochloride |
|---|---|
| PubChem CID | 17055804 |
| Molecular Formula | C23H27Cl3N2O2 |
| Molecular Weight | 469.84 g/mol |
| Exact Mass | 468.11 |
| IUPAC Name | N-[[4-[(6-chloro-3-pyridinyl)methoxy]-3-ethoxyphenyl]methyl]-1-phenylethanamine;dihydrochloride |
| SMILES | CCOc1cc(CNC(C)c2ccccc2)ccc1OCc1ccc(Cl)nc1.Cl.Cl |
| InChI | InChI=1S/C23H25ClN2O2.2ClH/c1-3-27-22-13-18(14-25-17(2)20-7-5-4-6-8-20)9-11-21(22)28-16-19-10-12-23(24)26-15-19;;/h4-13,15,17,25H,3,14,16H2,1-2H3;2*1H |
| InChIKey | XZRGDBMUEOZLJR-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.84 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|