C19H27Cl3N2O3 — CID 17055802
2-[[4-[(6-chloro-3-pyridinyl)methoxy]-3-ethoxyphenyl]methylamino]-2-methylpropan-1-ol;dihydrochloride (PubChem CID 17055802) has the molecular formula C19H27Cl3N2O3 and a molecular weight of 437.80 g/mol. Its IUPAC name is 2-[[4-[(6-chloro-3-pyridinyl)methoxy]-3-ethoxyphenyl]methylamino]-2-methylpropan-1-ol;dihydrochloride.
| Compound Name | 2-[[4-[(6-chloro-3-pyridinyl)methoxy]-3-ethoxyphenyl]methylamino]-2-methylpropan-1-ol;dihydrochloride |
|---|---|
| PubChem CID | 17055802 |
| Molecular Formula | C19H27Cl3N2O3 |
| Molecular Weight | 437.80 g/mol |
| Exact Mass | 436.11 |
| IUPAC Name | 2-[[4-[(6-chloro-3-pyridinyl)methoxy]-3-ethoxyphenyl]methylamino]-2-methylpropan-1-ol;dihydrochloride |
| SMILES | CCOc1cc(CNC(C)(C)CO)ccc1OCc1ccc(Cl)nc1.Cl.Cl |
| InChI | InChI=1S/C19H25ClN2O3.2ClH/c1-4-24-17-9-14(11-22-19(2,3)13-23)5-7-16(17)25-12-15-6-8-18(20)21-10-15;;/h5-10,22-23H,4,11-13H2,1-3H3;2*1H |
| InChIKey | LJJHWNLCQOUOSK-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 63.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.80 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|