C16H21Cl3N2O2 — CID 17055828
1-[4-[(6-chloro-3-pyridinyl)methoxy]-3-ethoxyphenyl]-N-methylmethanamine;dihydrochloride (PubChem CID 17055828) has the molecular formula C16H21Cl3N2O2 and a molecular weight of 379.72 g/mol. Its IUPAC name is 1-[4-[(6-chloro-3-pyridinyl)methoxy]-3-ethoxyphenyl]-N-methylmethanamine;dihydrochloride.
| Compound Name | 1-[4-[(6-chloro-3-pyridinyl)methoxy]-3-ethoxyphenyl]-N-methylmethanamine;dihydrochloride |
|---|---|
| PubChem CID | 17055828 |
| Molecular Formula | C16H21Cl3N2O2 |
| Molecular Weight | 379.72 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | 1-[4-[(6-chloro-3-pyridinyl)methoxy]-3-ethoxyphenyl]-N-methylmethanamine;dihydrochloride |
| SMILES | CCOc1cc(CNC)ccc1OCc1ccc(Cl)nc1.Cl.Cl |
| InChI | InChI=1S/C16H19ClN2O2.2ClH/c1-3-20-15-8-12(9-18-2)4-6-14(15)21-11-13-5-7-16(17)19-10-13;;/h4-8,10,18H,3,9,11H2,1-2H3;2*1H |
| InChIKey | MAHWCALVGNTXBP-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.72 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|