C23H26Cl3FN2O2 — CID 17055858
N-[[4-[(6-chloro-3-pyridinyl)methoxy]-3-ethoxyphenyl]methyl]-2-(2-fluorophenyl)ethanamine;dihydrochloride (PubChem CID 17055858) has the molecular formula C23H26Cl3FN2O2 and a molecular weight of 487.83 g/mol. Its IUPAC name is N-[[4-[(6-chloro-3-pyridinyl)methoxy]-3-ethoxyphenyl]methyl]-2-(2-fluorophenyl)ethanamine;dihydrochloride.
| Compound Name | N-[[4-[(6-chloro-3-pyridinyl)methoxy]-3-ethoxyphenyl]methyl]-2-(2-fluorophenyl)ethanamine;dihydrochloride |
|---|---|
| PubChem CID | 17055858 |
| Molecular Formula | C23H26Cl3FN2O2 |
| Molecular Weight | 487.83 g/mol |
| Exact Mass | 486.10 |
| IUPAC Name | N-[[4-[(6-chloro-3-pyridinyl)methoxy]-3-ethoxyphenyl]methyl]-2-(2-fluorophenyl)ethanamine;dihydrochloride |
| SMILES | CCOc1cc(CNCCc2ccccc2F)ccc1OCc1ccc(Cl)nc1.Cl.Cl |
| InChI | InChI=1S/C23H24ClFN2O2.2ClH/c1-2-28-22-13-17(14-26-12-11-19-5-3-4-6-20(19)25)7-9-21(22)29-16-18-8-10-23(24)27-15-18;;/h3-10,13,15,26H,2,11-12,14,16H2,1H3;2*1H |
| InChIKey | HQZDTRIIFYWLAY-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.83 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|