C23H22Cl2FNO2 — CID 4719683
N-[[4-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methyl]-2-(2-fluorophenyl)ethanamine (PubChem CID 4719683) has the molecular formula C23H22Cl2FNO2 and a molecular weight of 434.34 g/mol. Its IUPAC name is N-[[4-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methyl]-2-(2-fluorophenyl)ethanamine.
| Compound Name | N-[[4-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methyl]-2-(2-fluorophenyl)ethanamine |
|---|---|
| PubChem CID | 4719683 |
| Molecular Formula | C23H22Cl2FNO2 |
| Molecular Weight | 434.34 g/mol |
| Exact Mass | 433.10 |
| IUPAC Name | N-[[4-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methyl]-2-(2-fluorophenyl)ethanamine |
| SMILES | COc1cc(CNCCc2ccccc2F)ccc1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C23H22Cl2FNO2/c1-28-23-13-16(14-27-11-10-18-4-2-3-5-21(18)26)7-9-22(23)29-15-17-6-8-19(24)20(25)12-17/h2-9,12-13,27H,10-11,14-15H2,1H3 |
| InChIKey | JLZOFUDSAPIZLB-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.34 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|