C23H22Cl5NO2 — CID 17209792
2-(2,4-dichlorophenyl)-N-[[4-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methyl]ethanamine;hydrochloride (PubChem CID 17209792) has the molecular formula C23H22Cl5NO2 and a molecular weight of 521.70 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-N-[[4-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methyl]ethanamine;hydrochloride.
| Compound Name | 2-(2,4-dichlorophenyl)-N-[[4-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methyl]ethanamine;hydrochloride |
|---|---|
| PubChem CID | 17209792 |
| Molecular Formula | C23H22Cl5NO2 |
| Molecular Weight | 521.70 g/mol |
| Exact Mass | 519.01 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-N-[[4-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methyl]ethanamine;hydrochloride |
| SMILES | COc1cc(CNCCc2ccc(Cl)cc2Cl)ccc1OCc1ccc(Cl)c(Cl)c1.Cl |
| InChI | InChI=1S/C23H21Cl4NO2.ClH/c1-29-23-11-15(13-28-9-8-17-4-5-18(24)12-20(17)26)3-7-22(23)30-14-16-2-6-19(25)21(27)10-16;/h2-7,10-12,28H,8-9,13-14H2,1H3;1H |
| InChIKey | UPFIFICTBIATPF-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.70 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|