C19H33NO2 — CID 4722949
N-[(3,4-diethoxyphenyl)methyl]-2,4,4-trimethylpentan-2-amine (PubChem CID 4722949) has the molecular formula C19H33NO2 and a molecular weight of 307.48 g/mol. Its IUPAC name is N-[(3,4-diethoxyphenyl)methyl]-2,4,4-trimethylpentan-2-amine.
| Compound Name | N-[(3,4-diethoxyphenyl)methyl]-2,4,4-trimethylpentan-2-amine |
|---|---|
| PubChem CID | 4722949 |
| Molecular Formula | C19H33NO2 |
| Molecular Weight | 307.48 g/mol |
| Exact Mass | 307.25 |
| IUPAC Name | N-[(3,4-diethoxyphenyl)methyl]-2,4,4-trimethylpentan-2-amine |
| SMILES | CCOc1ccc(CNC(C)(C)CC(C)(C)C)cc1OCC |
| InChI | InChI=1S/C19H33NO2/c1-8-21-16-11-10-15(12-17(16)22-9-2)13-20-19(6,7)14-18(3,4)5/h10-12,20H,8-9,13-14H2,1-7H3 |
| InChIKey | IFZLKWYUQWUBKF-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.48 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |