C16H24ClNO2 — CID 76983242
N-[[4-(3-chloroprop-2-enoxy)-3-ethoxyphenyl]methyl]-2-methylpropan-2-amine (PubChem CID 76983242) has the molecular formula C16H24ClNO2 and a molecular weight of 297.83 g/mol. Its IUPAC name is N-[[4-(3-chloroprop-2-enoxy)-3-ethoxyphenyl]methyl]-2-methylpropan-2-amine.
| Compound Name | N-[[4-(3-chloroprop-2-enoxy)-3-ethoxyphenyl]methyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 76983242 |
| Molecular Formula | C16H24ClNO2 |
| Molecular Weight | 297.83 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | N-[[4-(3-chloroprop-2-enoxy)-3-ethoxyphenyl]methyl]-2-methylpropan-2-amine |
| SMILES | CCOc1cc(CNC(C)(C)C)ccc1OCC=CCl |
| InChI | InChI=1S/C16H24ClNO2/c1-5-19-15-11-13(12-18-16(2,3)4)7-8-14(15)20-10-6-9-17/h6-9,11,18H,5,10,12H2,1-4H3 |
| InChIKey | ACKAEMFRVHTNMI-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.83 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |