C16H27NO3 — CID 29228499
2-[2-ethoxy-4-[(2-methylbutan-2-ylamino)methyl]phenoxy]ethanol (PubChem CID 29228499) has the molecular formula C16H27NO3 and a molecular weight of 281.40 g/mol. Its IUPAC name is 2-[2-ethoxy-4-[(2-methylbutan-2-ylamino)methyl]phenoxy]ethanol.
| Compound Name | 2-[2-ethoxy-4-[(2-methylbutan-2-ylamino)methyl]phenoxy]ethanol |
|---|---|
| PubChem CID | 29228499 |
| Molecular Formula | C16H27NO3 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.20 |
| IUPAC Name | 2-[2-ethoxy-4-[(2-methylbutan-2-ylamino)methyl]phenoxy]ethanol |
| SMILES | CCOc1cc(CNC(C)(C)CC)ccc1OCCO |
| InChI | InChI=1S/C16H27NO3/c1-5-16(3,4)17-12-13-7-8-14(20-10-9-18)15(11-13)19-6-2/h7-8,11,17-18H,5-6,9-10,12H2,1-4H3 |
| InChIKey | CLRLHDGAPRFCCM-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |