C19H25NO4 — CID 29228432
2-[2-ethoxy-4-[[(4-methoxyphenyl)methylamino]methyl]phenoxy]ethanol (PubChem CID 29228432) has the molecular formula C19H25NO4 and a molecular weight of 331.41 g/mol. Its IUPAC name is 2-[2-ethoxy-4-[[(4-methoxyphenyl)methylamino]methyl]phenoxy]ethanol.
| Compound Name | 2-[2-ethoxy-4-[[(4-methoxyphenyl)methylamino]methyl]phenoxy]ethanol |
|---|---|
| PubChem CID | 29228432 |
| Molecular Formula | C19H25NO4 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | 2-[2-ethoxy-4-[[(4-methoxyphenyl)methylamino]methyl]phenoxy]ethanol |
| SMILES | CCOc1cc(CNCc2ccc(OC)cc2)ccc1OCCO |
| InChI | InChI=1S/C19H25NO4/c1-3-23-19-12-16(6-9-18(19)24-11-10-21)14-20-13-15-4-7-17(22-2)8-5-15/h4-9,12,20-21H,3,10-11,13-14H2,1-2H3 |
| InChIKey | CDXLQGNKEZPVFA-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |