C22H40N2O3 — CID 29242019
2-[4-[[3-(dibutylamino)propylamino]methyl]-2-ethoxyphenoxy]ethanol (PubChem CID 29242019) has the molecular formula C22H40N2O3 and a molecular weight of 380.57 g/mol. Its IUPAC name is 2-[4-[[3-(dibutylamino)propylamino]methyl]-2-ethoxyphenoxy]ethanol.
| Compound Name | 2-[4-[[3-(dibutylamino)propylamino]methyl]-2-ethoxyphenoxy]ethanol |
|---|---|
| PubChem CID | 29242019 |
| Molecular Formula | C22H40N2O3 |
| Molecular Weight | 380.57 g/mol |
| Exact Mass | 380.30 |
| IUPAC Name | 2-[4-[[3-(dibutylamino)propylamino]methyl]-2-ethoxyphenoxy]ethanol |
| SMILES | CCCCN(CCCC)CCCNCc1ccc(OCCO)c(OCC)c1 |
| InChI | InChI=1S/C22H40N2O3/c1-4-7-13-24(14-8-5-2)15-9-12-23-19-20-10-11-21(27-17-16-25)22(18-20)26-6-3/h10-11,18,23,25H,4-9,12-17,19H2,1-3H3 |
| InChIKey | GIWYRFHBKNBYKJ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 53.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.57 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|