C23H42Cl2N2O2 — CID 17214631
N',N'-dibutyl-N-[(3-ethoxy-4-prop-2-enoxyphenyl)methyl]propane-1,3-diamine;dihydrochloride (PubChem CID 17214631) has the molecular formula C23H42Cl2N2O2 and a molecular weight of 449.51 g/mol. Its IUPAC name is N',N'-dibutyl-N-[(3-ethoxy-4-prop-2-enoxyphenyl)methyl]propane-1,3-diamine;dihydrochloride.
| Compound Name | N',N'-dibutyl-N-[(3-ethoxy-4-prop-2-enoxyphenyl)methyl]propane-1,3-diamine;dihydrochloride |
|---|---|
| PubChem CID | 17214631 |
| Molecular Formula | C23H42Cl2N2O2 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 448.26 |
| IUPAC Name | N',N'-dibutyl-N-[(3-ethoxy-4-prop-2-enoxyphenyl)methyl]propane-1,3-diamine;dihydrochloride |
| SMILES | C=CCOc1ccc(CNCCCN(CCCC)CCCC)cc1OCC.Cl.Cl |
| InChI | InChI=1S/C23H40N2O2.2ClH/c1-5-9-15-25(16-10-6-2)17-11-14-24-20-21-12-13-22(27-18-7-3)23(19-21)26-8-4;;/h7,12-13,19,24H,3,5-6,8-11,14-18,20H2,1-2,4H3;2*1H |
| InChIKey | OPXBCDAAMCMBNN-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|