C20H38Cl2N2O2 — CID 17214443
N',N'-dibutyl-N-[(3,4-dimethoxyphenyl)methyl]propane-1,3-diamine;dihydrochloride (PubChem CID 17214443) has the molecular formula C20H38Cl2N2O2 and a molecular weight of 409.44 g/mol. Its IUPAC name is N',N'-dibutyl-N-[(3,4-dimethoxyphenyl)methyl]propane-1,3-diamine;dihydrochloride.
| Compound Name | N',N'-dibutyl-N-[(3,4-dimethoxyphenyl)methyl]propane-1,3-diamine;dihydrochloride |
|---|---|
| PubChem CID | 17214443 |
| Molecular Formula | C20H38Cl2N2O2 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | N',N'-dibutyl-N-[(3,4-dimethoxyphenyl)methyl]propane-1,3-diamine;dihydrochloride |
| SMILES | CCCCN(CCCC)CCCNCc1ccc(OC)c(OC)c1.Cl.Cl |
| InChI | InChI=1S/C20H36N2O2.2ClH/c1-5-7-13-22(14-8-6-2)15-9-12-21-17-18-10-11-19(23-3)20(16-18)24-4;;/h10-11,16,21H,5-9,12-15,17H2,1-4H3;2*1H |
| InChIKey | IBUMOYHQHVJDBC-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|