C26H40Cl4N2O2 — CID 17214703
N',N'-dibutyl-N-[[4-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]methyl]propane-1,3-diamine;dihydrochloride (PubChem CID 17214703) has the molecular formula C26H40Cl4N2O2 and a molecular weight of 554.43 g/mol. Its IUPAC name is N',N'-dibutyl-N-[[4-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]methyl]propane-1,3-diamine;dihydrochloride.
| Compound Name | N',N'-dibutyl-N-[[4-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]methyl]propane-1,3-diamine;dihydrochloride |
|---|---|
| PubChem CID | 17214703 |
| Molecular Formula | C26H40Cl4N2O2 |
| Molecular Weight | 554.43 g/mol |
| Exact Mass | 552.18 |
| IUPAC Name | N',N'-dibutyl-N-[[4-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]methyl]propane-1,3-diamine;dihydrochloride |
| SMILES | CCCCN(CCCC)CCCNCc1ccc(OCc2c(Cl)cccc2Cl)c(OC)c1.Cl.Cl |
| InChI | InChI=1S/C26H38Cl2N2O2.2ClH/c1-4-6-15-30(16-7-5-2)17-9-14-29-19-21-12-13-25(26(18-21)31-3)32-20-22-23(27)10-8-11-24(22)28;;/h8,10-13,18,29H,4-7,9,14-17,19-20H2,1-3H3;2*1H |
| InChIKey | LSSMAWXIHXRLFL-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.43 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|