C22H29BrCl2N2O2 — CID 66538140
N-[[2-bromo-4-[(2,6-dichlorophenyl)methoxy]-5-methoxyphenyl]methyl]-N',N'-diethylpropane-1,3-diamine (PubChem CID 66538140) has the molecular formula C22H29BrCl2N2O2 and a molecular weight of 504.30 g/mol. Its IUPAC name is N-[[2-bromo-4-[(2,6-dichlorophenyl)methoxy]-5-methoxyphenyl]methyl]-N',N'-diethylpropane-1,3-diamine.
| Compound Name | N-[[2-bromo-4-[(2,6-dichlorophenyl)methoxy]-5-methoxyphenyl]methyl]-N',N'-diethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 66538140 |
| Molecular Formula | C22H29BrCl2N2O2 |
| Molecular Weight | 504.30 g/mol |
| Exact Mass | 502.08 |
| IUPAC Name | N-[[2-bromo-4-[(2,6-dichlorophenyl)methoxy]-5-methoxyphenyl]methyl]-N',N'-diethylpropane-1,3-diamine |
| SMILES | CCN(CC)CCCNCc1cc(OC)c(OCc2c(Cl)cccc2Cl)cc1Br |
| InChI | InChI=1S/C22H29BrCl2N2O2/c1-4-27(5-2)11-7-10-26-14-16-12-21(28-3)22(13-18(16)23)29-15-17-19(24)8-6-9-20(17)25/h6,8-9,12-13,26H,4-5,7,10-11,14-15H2,1-3H3 |
| InChIKey | RJAAHWZPUGJKMC-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.30 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|