C22H29BrClNO3 — CID 66534295
N-[[2-bromo-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]methyl]-3-butoxypropan-1-amine (PubChem CID 66534295) has the molecular formula C22H29BrClNO3 and a molecular weight of 470.84 g/mol. Its IUPAC name is N-[[2-bromo-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]methyl]-3-butoxypropan-1-amine.
| Compound Name | N-[[2-bromo-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]methyl]-3-butoxypropan-1-amine |
|---|---|
| PubChem CID | 66534295 |
| Molecular Formula | C22H29BrClNO3 |
| Molecular Weight | 470.84 g/mol |
| Exact Mass | 469.10 |
| IUPAC Name | N-[[2-bromo-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]methyl]-3-butoxypropan-1-amine |
| SMILES | CCCCOCCCNCc1cc(OC)c(OCc2ccccc2Cl)cc1Br |
| InChI | InChI=1S/C22H29BrClNO3/c1-3-4-11-27-12-7-10-25-15-18-13-21(26-2)22(14-19(18)23)28-16-17-8-5-6-9-20(17)24/h5-6,8-9,13-14,25H,3-4,7,10-12,15-16H2,1-2H3 |
| InChIKey | PHXQSFHBQODOPI-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.84 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|