C20H25BrClNO3 — CID 66532777
N-[[2-bromo-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-3-methoxypropan-1-amine (PubChem CID 66532777) has the molecular formula C20H25BrClNO3 and a molecular weight of 442.78 g/mol. Its IUPAC name is N-[[2-bromo-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-3-methoxypropan-1-amine.
| Compound Name | N-[[2-bromo-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-3-methoxypropan-1-amine |
|---|---|
| PubChem CID | 66532777 |
| Molecular Formula | C20H25BrClNO3 |
| Molecular Weight | 442.78 g/mol |
| Exact Mass | 441.07 |
| IUPAC Name | N-[[2-bromo-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-3-methoxypropan-1-amine |
| SMILES | CCOc1cc(CNCCCOC)c(Br)cc1OCc1ccccc1Cl |
| InChI | InChI=1S/C20H25BrClNO3/c1-3-25-19-11-16(13-23-9-6-10-24-2)17(21)12-20(19)26-14-15-7-4-5-8-18(15)22/h4-5,7-8,11-12,23H,3,6,9-10,13-14H2,1-2H3 |
| InChIKey | SFEPBUUZDDTRBC-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.78 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|