C23H30BrCl2NO2 — CID 66532640
N-[[2-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methyl]heptan-1-amine (PubChem CID 66532640) has the molecular formula C23H30BrCl2NO2 and a molecular weight of 503.31 g/mol. Its IUPAC name is N-[[2-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methyl]heptan-1-amine.
| Compound Name | N-[[2-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methyl]heptan-1-amine |
|---|---|
| PubChem CID | 66532640 |
| Molecular Formula | C23H30BrCl2NO2 |
| Molecular Weight | 503.31 g/mol |
| Exact Mass | 501.08 |
| IUPAC Name | N-[[2-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methyl]heptan-1-amine |
| SMILES | CCCCCCCNCc1cc(OCC)c(OCc2ccc(Cl)cc2Cl)cc1Br |
| InChI | InChI=1S/C23H30BrCl2NO2/c1-3-5-6-7-8-11-27-15-18-12-22(28-4-2)23(14-20(18)24)29-16-17-9-10-19(25)13-21(17)26/h9-10,12-14,27H,3-8,11,15-16H2,1-2H3 |
| InChIKey | IVODYYDWOMCKON-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.31 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|