C20H24Cl3NO — CID 4716843
N-[[5-chloro-2-[(2,4-dichlorophenyl)methoxy]phenyl]methyl]hexan-1-amine (PubChem CID 4716843) has the molecular formula C20H24Cl3NO and a molecular weight of 400.78 g/mol. Its IUPAC name is N-[[5-chloro-2-[(2,4-dichlorophenyl)methoxy]phenyl]methyl]hexan-1-amine.
| Compound Name | N-[[5-chloro-2-[(2,4-dichlorophenyl)methoxy]phenyl]methyl]hexan-1-amine |
|---|---|
| PubChem CID | 4716843 |
| Molecular Formula | C20H24Cl3NO |
| Molecular Weight | 400.78 g/mol |
| Exact Mass | 399.09 |
| IUPAC Name | N-[[5-chloro-2-[(2,4-dichlorophenyl)methoxy]phenyl]methyl]hexan-1-amine |
| SMILES | CCCCCCNCc1cc(Cl)ccc1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C20H24Cl3NO/c1-2-3-4-5-10-24-13-16-11-17(21)8-9-20(16)25-14-15-6-7-18(22)12-19(15)23/h6-9,11-12,24H,2-5,10,13-14H2,1H3 |
| InChIKey | PTTPKTSKDDCBQN-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.78 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|