C21H26BrCl2NO2 — CID 17207665
N-[[5-bromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methyl]-3-butoxypropan-1-amine (PubChem CID 17207665) has the molecular formula C21H26BrCl2NO2 and a molecular weight of 475.25 g/mol. Its IUPAC name is N-[[5-bromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methyl]-3-butoxypropan-1-amine.
| Compound Name | N-[[5-bromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methyl]-3-butoxypropan-1-amine |
|---|---|
| PubChem CID | 17207665 |
| Molecular Formula | C21H26BrCl2NO2 |
| Molecular Weight | 475.25 g/mol |
| Exact Mass | 473.05 |
| IUPAC Name | N-[[5-bromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methyl]-3-butoxypropan-1-amine |
| SMILES | CCCCOCCCNCc1cc(Br)ccc1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C21H26BrCl2NO2/c1-2-3-10-26-11-4-9-25-14-17-12-18(22)6-8-21(17)27-15-16-5-7-19(23)13-20(16)24/h5-8,12-13,25H,2-4,9-11,14-15H2,1H3 |
| InChIKey | GVXIVOMVYILFFS-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.25 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|