C22H29Cl2NO3 — CID 17207603
3-butoxy-N-[[2-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methyl]propan-1-amine (PubChem CID 17207603) has the molecular formula C22H29Cl2NO3 and a molecular weight of 426.38 g/mol. Its IUPAC name is 3-butoxy-N-[[2-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methyl]propan-1-amine.
| Compound Name | 3-butoxy-N-[[2-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 17207603 |
| Molecular Formula | C22H29Cl2NO3 |
| Molecular Weight | 426.38 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | 3-butoxy-N-[[2-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methyl]propan-1-amine |
| SMILES | CCCCOCCCNCc1cccc(OC)c1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C22H29Cl2NO3/c1-3-4-12-27-13-6-11-25-15-17-7-5-8-21(26-2)22(17)28-16-18-9-10-19(23)14-20(18)24/h5,7-10,14,25H,3-4,6,11-13,15-16H2,1-2H3 |
| InChIKey | MSUCYYIHHOWZFN-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.38 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|