C22H28BrClFNO3 — CID 66536488
N-[[6-bromo-2-[(2-chloro-4-fluorophenyl)methoxy]-3-methoxyphenyl]methyl]-3-butoxypropan-1-amine (PubChem CID 66536488) has the molecular formula C22H28BrClFNO3 and a molecular weight of 488.83 g/mol. Its IUPAC name is N-[[6-bromo-2-[(2-chloro-4-fluorophenyl)methoxy]-3-methoxyphenyl]methyl]-3-butoxypropan-1-amine.
| Compound Name | N-[[6-bromo-2-[(2-chloro-4-fluorophenyl)methoxy]-3-methoxyphenyl]methyl]-3-butoxypropan-1-amine |
|---|---|
| PubChem CID | 66536488 |
| Molecular Formula | C22H28BrClFNO3 |
| Molecular Weight | 488.83 g/mol |
| Exact Mass | 487.09 |
| IUPAC Name | N-[[6-bromo-2-[(2-chloro-4-fluorophenyl)methoxy]-3-methoxyphenyl]methyl]-3-butoxypropan-1-amine |
| SMILES | CCCCOCCCNCc1c(Br)ccc(OC)c1OCc1ccc(F)cc1Cl |
| InChI | InChI=1S/C22H28BrClFNO3/c1-3-4-11-28-12-5-10-26-14-18-19(23)8-9-21(27-2)22(18)29-15-16-6-7-17(25)13-20(16)24/h6-9,13,26H,3-5,10-12,14-15H2,1-2H3 |
| InChIKey | QAHCZIWOZKEFRB-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.83 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|