C23H21BrCl2FNO2 — CID 66535931
N-[[6-bromo-2-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methyl]-2-(2,4-dichlorophenyl)ethanamine (PubChem CID 66535931) has the molecular formula C23H21BrCl2FNO2 and a molecular weight of 513.23 g/mol. Its IUPAC name is N-[[6-bromo-2-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methyl]-2-(2,4-dichlorophenyl)ethanamine.
| Compound Name | N-[[6-bromo-2-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methyl]-2-(2,4-dichlorophenyl)ethanamine |
|---|---|
| PubChem CID | 66535931 |
| Molecular Formula | C23H21BrCl2FNO2 |
| Molecular Weight | 513.23 g/mol |
| Exact Mass | 511.01 |
| IUPAC Name | N-[[6-bromo-2-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methyl]-2-(2,4-dichlorophenyl)ethanamine |
| SMILES | COc1ccc(Br)c(CNCCc2ccc(Cl)cc2Cl)c1OCc1ccc(F)cc1 |
| InChI | InChI=1S/C23H21BrCl2FNO2/c1-29-22-9-8-20(24)19(23(22)30-14-15-2-6-18(27)7-3-15)13-28-11-10-16-4-5-17(25)12-21(16)26/h2-9,12,28H,10-11,13-14H2,1H3 |
| InChIKey | WEAOOSLEPTVLAN-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.23 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|