C23H21BrCl2N2O4 — CID 66536420
N-[[6-bromo-3-methoxy-2-[(4-nitrophenyl)methoxy]phenyl]methyl]-2-(2,4-dichlorophenyl)ethanamine (PubChem CID 66536420) has the molecular formula C23H21BrCl2N2O4 and a molecular weight of 540.24 g/mol. Its IUPAC name is N-[[6-bromo-3-methoxy-2-[(4-nitrophenyl)methoxy]phenyl]methyl]-2-(2,4-dichlorophenyl)ethanamine.
| Compound Name | N-[[6-bromo-3-methoxy-2-[(4-nitrophenyl)methoxy]phenyl]methyl]-2-(2,4-dichlorophenyl)ethanamine |
|---|---|
| PubChem CID | 66536420 |
| Molecular Formula | C23H21BrCl2N2O4 |
| Molecular Weight | 540.24 g/mol |
| Exact Mass | 538.01 |
| IUPAC Name | N-[[6-bromo-3-methoxy-2-[(4-nitrophenyl)methoxy]phenyl]methyl]-2-(2,4-dichlorophenyl)ethanamine |
| SMILES | COc1ccc(Br)c(CNCCc2ccc(Cl)cc2Cl)c1OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H21BrCl2N2O4/c1-31-22-9-8-20(24)19(13-27-11-10-16-4-5-17(25)12-21(16)26)23(22)32-14-15-2-6-18(7-3-15)28(29)30/h2-9,12,27H,10-11,13-14H2,1H3 |
| InChIKey | AXQCZZGORDVOLX-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.24 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|