C17H19BrN2O5 — CID 66536345
2-[[6-bromo-3-methoxy-2-[(4-nitrophenyl)methoxy]phenyl]methylamino]ethanol (PubChem CID 66536345) has the molecular formula C17H19BrN2O5 and a molecular weight of 411.25 g/mol. Its IUPAC name is 2-[[6-bromo-3-methoxy-2-[(4-nitrophenyl)methoxy]phenyl]methylamino]ethanol.
| Compound Name | 2-[[6-bromo-3-methoxy-2-[(4-nitrophenyl)methoxy]phenyl]methylamino]ethanol |
|---|---|
| PubChem CID | 66536345 |
| Molecular Formula | C17H19BrN2O5 |
| Molecular Weight | 411.25 g/mol |
| Exact Mass | 410.05 |
| IUPAC Name | 2-[[6-bromo-3-methoxy-2-[(4-nitrophenyl)methoxy]phenyl]methylamino]ethanol |
| SMILES | COc1ccc(Br)c(CNCCO)c1OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H19BrN2O5/c1-24-16-7-6-15(18)14(10-19-8-9-21)17(16)25-11-12-2-4-13(5-3-12)20(22)23/h2-7,19,21H,8-11H2,1H3 |
| InChIKey | VYINWIZBQSOTBK-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 93.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.25 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|