C21H23BrN4O4 — CID 66536367
N-[[6-bromo-3-methoxy-2-[(4-nitrophenyl)methoxy]phenyl]methyl]-3-imidazol-1-ylpropan-1-amine (PubChem CID 66536367) has the molecular formula C21H23BrN4O4 and a molecular weight of 475.34 g/mol. Its IUPAC name is N-[[6-bromo-3-methoxy-2-[(4-nitrophenyl)methoxy]phenyl]methyl]-3-imidazol-1-ylpropan-1-amine.
| Compound Name | N-[[6-bromo-3-methoxy-2-[(4-nitrophenyl)methoxy]phenyl]methyl]-3-imidazol-1-ylpropan-1-amine |
|---|---|
| PubChem CID | 66536367 |
| Molecular Formula | C21H23BrN4O4 |
| Molecular Weight | 475.34 g/mol |
| Exact Mass | 474.09 |
| IUPAC Name | N-[[6-bromo-3-methoxy-2-[(4-nitrophenyl)methoxy]phenyl]methyl]-3-imidazol-1-ylpropan-1-amine |
| SMILES | COc1ccc(Br)c(CNCCCn2ccnc2)c1OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H23BrN4O4/c1-29-20-8-7-19(22)18(13-23-9-2-11-25-12-10-24-15-25)21(20)30-14-16-3-5-17(6-4-16)26(27)28/h3-8,10,12,15,23H,2,9,11,13-14H2,1H3 |
| InChIKey | DVHIUEWJOABFGG-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 91.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.34 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|