C13H17ClN4O2 — CID 17155577
3-imidazol-1-yl-N-[(4-nitrophenyl)methyl]propan-1-amine;hydrochloride (PubChem CID 17155577) has the molecular formula C13H17ClN4O2 and a molecular weight of 296.76 g/mol. Its IUPAC name is 3-imidazol-1-yl-N-[(4-nitrophenyl)methyl]propan-1-amine;hydrochloride.
| Compound Name | 3-imidazol-1-yl-N-[(4-nitrophenyl)methyl]propan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 17155577 |
| Molecular Formula | C13H17ClN4O2 |
| Molecular Weight | 296.76 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | 3-imidazol-1-yl-N-[(4-nitrophenyl)methyl]propan-1-amine;hydrochloride |
| SMILES | Cl.O=[N+]([O-])c1ccc(CNCCCn2ccnc2)cc1 |
| InChI | InChI=1S/C13H16N4O2.ClH/c18-17(19)13-4-2-12(3-5-13)10-14-6-1-8-16-9-7-15-11-16;/h2-5,7,9,11,14H,1,6,8,10H2;1H |
| InChIKey | AMZWZUSKKXAEHR-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 72.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.76 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|