C19H23BrN2O5 — CID 66536346
2-[[6-bromo-3-methoxy-2-[(4-nitrophenyl)methoxy]phenyl]methylamino]-2-methylpropan-1-ol (PubChem CID 66536346) has the molecular formula C19H23BrN2O5 and a molecular weight of 439.31 g/mol. Its IUPAC name is 2-[[6-bromo-3-methoxy-2-[(4-nitrophenyl)methoxy]phenyl]methylamino]-2-methylpropan-1-ol.
| Compound Name | 2-[[6-bromo-3-methoxy-2-[(4-nitrophenyl)methoxy]phenyl]methylamino]-2-methylpropan-1-ol |
|---|---|
| PubChem CID | 66536346 |
| Molecular Formula | C19H23BrN2O5 |
| Molecular Weight | 439.31 g/mol |
| Exact Mass | 438.08 |
| IUPAC Name | 2-[[6-bromo-3-methoxy-2-[(4-nitrophenyl)methoxy]phenyl]methylamino]-2-methylpropan-1-ol |
| SMILES | COc1ccc(Br)c(CNC(C)(C)CO)c1OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H23BrN2O5/c1-19(2,12-23)21-10-15-16(20)8-9-17(26-3)18(15)27-11-13-4-6-14(7-5-13)22(24)25/h4-9,21,23H,10-12H2,1-3H3 |
| InChIKey | UHYUTBNKXMGNOM-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 93.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.31 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|