C21H25BrN2O4 — CID 66536317
N-[[6-bromo-3-methoxy-2-[(4-nitrophenyl)methoxy]phenyl]methyl]cyclohexanamine (PubChem CID 66536317) has the molecular formula C21H25BrN2O4 and a molecular weight of 449.35 g/mol. Its IUPAC name is N-[[6-bromo-3-methoxy-2-[(4-nitrophenyl)methoxy]phenyl]methyl]cyclohexanamine.
| Compound Name | N-[[6-bromo-3-methoxy-2-[(4-nitrophenyl)methoxy]phenyl]methyl]cyclohexanamine |
|---|---|
| PubChem CID | 66536317 |
| Molecular Formula | C21H25BrN2O4 |
| Molecular Weight | 449.35 g/mol |
| Exact Mass | 448.10 |
| IUPAC Name | N-[[6-bromo-3-methoxy-2-[(4-nitrophenyl)methoxy]phenyl]methyl]cyclohexanamine |
| SMILES | COc1ccc(Br)c(CNC2CCCCC2)c1OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H25BrN2O4/c1-27-20-12-11-19(22)18(13-23-16-5-3-2-4-6-16)21(20)28-14-15-7-9-17(10-8-15)24(25)26/h7-12,16,23H,2-6,13-14H2,1H3 |
| InChIKey | KTLLBRBOSVKOAK-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.35 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|