C21H26BrNO2 — CID 66536208
N-[[6-bromo-3-methoxy-2-[(4-methylphenyl)methoxy]phenyl]methyl]cyclopentanamine (PubChem CID 66536208) has the molecular formula C21H26BrNO2 and a molecular weight of 404.35 g/mol. Its IUPAC name is N-[[6-bromo-3-methoxy-2-[(4-methylphenyl)methoxy]phenyl]methyl]cyclopentanamine.
| Compound Name | N-[[6-bromo-3-methoxy-2-[(4-methylphenyl)methoxy]phenyl]methyl]cyclopentanamine |
|---|---|
| PubChem CID | 66536208 |
| Molecular Formula | C21H26BrNO2 |
| Molecular Weight | 404.35 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | N-[[6-bromo-3-methoxy-2-[(4-methylphenyl)methoxy]phenyl]methyl]cyclopentanamine |
| SMILES | COc1ccc(Br)c(CNC2CCCC2)c1OCc1ccc(C)cc1 |
| InChI | InChI=1S/C21H26BrNO2/c1-15-7-9-16(10-8-15)14-25-21-18(13-23-17-5-3-4-6-17)19(22)11-12-20(21)24-2/h7-12,17,23H,3-6,13-14H2,1-2H3 |
| InChIKey | OJWYPRLBFSYEMS-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.35 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |