C22H29BrN2O3 — CID 66538545
N-[[6-bromo-3-methoxy-2-[(4-methylphenyl)methoxy]phenyl]methyl]-2-morpholin-4-ylethanamine (PubChem CID 66538545) has the molecular formula C22H29BrN2O3 and a molecular weight of 449.39 g/mol. Its IUPAC name is N-[[6-bromo-3-methoxy-2-[(4-methylphenyl)methoxy]phenyl]methyl]-2-morpholin-4-ylethanamine.
| Compound Name | N-[[6-bromo-3-methoxy-2-[(4-methylphenyl)methoxy]phenyl]methyl]-2-morpholin-4-ylethanamine |
|---|---|
| PubChem CID | 66538545 |
| Molecular Formula | C22H29BrN2O3 |
| Molecular Weight | 449.39 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | N-[[6-bromo-3-methoxy-2-[(4-methylphenyl)methoxy]phenyl]methyl]-2-morpholin-4-ylethanamine |
| SMILES | COc1ccc(Br)c(CNCCN2CCOCC2)c1OCc1ccc(C)cc1 |
| InChI | InChI=1S/C22H29BrN2O3/c1-17-3-5-18(6-4-17)16-28-22-19(20(23)7-8-21(22)26-2)15-24-9-10-25-11-13-27-14-12-25/h3-8,24H,9-16H2,1-2H3 |
| InChIKey | WJTXOSHPFJWHAI-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.39 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|