C24H24BrCl2NO2 — CID 66536256
N-[[6-bromo-3-methoxy-2-[(4-methylphenyl)methoxy]phenyl]methyl]-2-(2,4-dichlorophenyl)ethanamine (PubChem CID 66536256) has the molecular formula C24H24BrCl2NO2 and a molecular weight of 509.27 g/mol. Its IUPAC name is N-[[6-bromo-3-methoxy-2-[(4-methylphenyl)methoxy]phenyl]methyl]-2-(2,4-dichlorophenyl)ethanamine.
| Compound Name | N-[[6-bromo-3-methoxy-2-[(4-methylphenyl)methoxy]phenyl]methyl]-2-(2,4-dichlorophenyl)ethanamine |
|---|---|
| PubChem CID | 66536256 |
| Molecular Formula | C24H24BrCl2NO2 |
| Molecular Weight | 509.27 g/mol |
| Exact Mass | 507.04 |
| IUPAC Name | N-[[6-bromo-3-methoxy-2-[(4-methylphenyl)methoxy]phenyl]methyl]-2-(2,4-dichlorophenyl)ethanamine |
| SMILES | COc1ccc(Br)c(CNCCc2ccc(Cl)cc2Cl)c1OCc1ccc(C)cc1 |
| InChI | InChI=1S/C24H24BrCl2NO2/c1-16-3-5-17(6-4-16)15-30-24-20(21(25)9-10-23(24)29-2)14-28-12-11-18-7-8-19(26)13-22(18)27/h3-10,13,28H,11-12,14-15H2,1-2H3 |
| InChIKey | MRRFHKIYPUXOQY-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.27 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|