C17H19BrClNO3 — CID 66536094
2-[[6-bromo-2-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylamino]ethanol (PubChem CID 66536094) has the molecular formula C17H19BrClNO3 and a molecular weight of 400.70 g/mol. Its IUPAC name is 2-[[6-bromo-2-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylamino]ethanol.
| Compound Name | 2-[[6-bromo-2-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylamino]ethanol |
|---|---|
| PubChem CID | 66536094 |
| Molecular Formula | C17H19BrClNO3 |
| Molecular Weight | 400.70 g/mol |
| Exact Mass | 399.02 |
| IUPAC Name | 2-[[6-bromo-2-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylamino]ethanol |
| SMILES | COc1ccc(Br)c(CNCCO)c1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H19BrClNO3/c1-22-16-7-6-15(18)14(10-20-8-9-21)17(16)23-11-12-2-4-13(19)5-3-12/h2-7,20-21H,8-11H2,1H3 |
| InChIKey | VRYZTWYOKCPDSI-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.70 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|