C13H20BrNO3 — CID 66537178
2-[(6-bromo-3-methoxy-2-propoxyphenyl)methylamino]ethanol (PubChem CID 66537178) has the molecular formula C13H20BrNO3 and a molecular weight of 318.21 g/mol. Its IUPAC name is 2-[(6-bromo-3-methoxy-2-propoxyphenyl)methylamino]ethanol.
| Compound Name | 2-[(6-bromo-3-methoxy-2-propoxyphenyl)methylamino]ethanol |
|---|---|
| PubChem CID | 66537178 |
| Molecular Formula | C13H20BrNO3 |
| Molecular Weight | 318.21 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | 2-[(6-bromo-3-methoxy-2-propoxyphenyl)methylamino]ethanol |
| SMILES | CCCOc1c(OC)ccc(Br)c1CNCCO |
| InChI | InChI=1S/C13H20BrNO3/c1-3-8-18-13-10(9-15-6-7-16)11(14)4-5-12(13)17-2/h4-5,15-16H,3,6-9H2,1-2H3 |
| InChIKey | JKVIRPWRPDERIT-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.21 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|