C17H29BrN2O2 — CID 66539002
N-[(6-bromo-2-ethoxy-3-methoxyphenyl)methyl]-N',N'-diethylpropane-1,3-diamine (PubChem CID 66539002) has the molecular formula C17H29BrN2O2 and a molecular weight of 373.34 g/mol. Its IUPAC name is N-[(6-bromo-2-ethoxy-3-methoxyphenyl)methyl]-N',N'-diethylpropane-1,3-diamine.
| Compound Name | N-[(6-bromo-2-ethoxy-3-methoxyphenyl)methyl]-N',N'-diethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 66539002 |
| Molecular Formula | C17H29BrN2O2 |
| Molecular Weight | 373.34 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | N-[(6-bromo-2-ethoxy-3-methoxyphenyl)methyl]-N',N'-diethylpropane-1,3-diamine |
| SMILES | CCOc1c(OC)ccc(Br)c1CNCCCN(CC)CC |
| InChI | InChI=1S/C17H29BrN2O2/c1-5-20(6-2)12-8-11-19-13-14-15(18)9-10-16(21-4)17(14)22-7-3/h9-10,19H,5-8,11-13H2,1-4H3 |
| InChIKey | AYILKLRYJOEBJC-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.34 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|