C20H25BrCl2N2O2 — CID 66538452
N-[[6-bromo-2-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]methyl]-N',N'-dimethylpropane-1,3-diamine (PubChem CID 66538452) has the molecular formula C20H25BrCl2N2O2 and a molecular weight of 476.24 g/mol. Its IUPAC name is N-[[6-bromo-2-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]methyl]-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-[[6-bromo-2-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]methyl]-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 66538452 |
| Molecular Formula | C20H25BrCl2N2O2 |
| Molecular Weight | 476.24 g/mol |
| Exact Mass | 474.05 |
| IUPAC Name | N-[[6-bromo-2-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]methyl]-N',N'-dimethylpropane-1,3-diamine |
| SMILES | COc1ccc(Br)c(CNCCCN(C)C)c1OCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C20H25BrCl2N2O2/c1-25(2)11-5-10-24-12-14-16(21)8-9-19(26-3)20(14)27-13-15-17(22)6-4-7-18(15)23/h4,6-9,24H,5,10-13H2,1-3H3 |
| InChIKey | ZMXWSLFXGKGMFU-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.24 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|