C25H23BrCl2N2O2 — CID 66536552
N-[[6-bromo-2-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]methyl]-2-(1H-indol-3-yl)ethanamine (PubChem CID 66536552) has the molecular formula C25H23BrCl2N2O2 and a molecular weight of 534.28 g/mol. Its IUPAC name is N-[[6-bromo-2-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]methyl]-2-(1H-indol-3-yl)ethanamine.
| Compound Name | N-[[6-bromo-2-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]methyl]-2-(1H-indol-3-yl)ethanamine |
|---|---|
| PubChem CID | 66536552 |
| Molecular Formula | C25H23BrCl2N2O2 |
| Molecular Weight | 534.28 g/mol |
| Exact Mass | 532.03 |
| IUPAC Name | N-[[6-bromo-2-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]methyl]-2-(1H-indol-3-yl)ethanamine |
| SMILES | COc1ccc(Br)c(CNCCc2c[nH]c3ccccc23)c1OCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C25H23BrCl2N2O2/c1-31-24-10-9-20(26)18(25(24)32-15-19-21(27)6-4-7-22(19)28)14-29-12-11-16-13-30-23-8-3-2-5-17(16)23/h2-10,13,29-30H,11-12,14-15H2,1H3 |
| InChIKey | DXVZGNBNBUGQKB-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 46.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.28 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|