C24H24BrCl2NO3 — CID 66536962
N-[[6-bromo-2-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methyl]-2-(2-methoxyphenyl)ethanamine (PubChem CID 66536962) has the molecular formula C24H24BrCl2NO3 and a molecular weight of 525.27 g/mol. Its IUPAC name is N-[[6-bromo-2-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methyl]-2-(2-methoxyphenyl)ethanamine.
| Compound Name | N-[[6-bromo-2-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methyl]-2-(2-methoxyphenyl)ethanamine |
|---|---|
| PubChem CID | 66536962 |
| Molecular Formula | C24H24BrCl2NO3 |
| Molecular Weight | 525.27 g/mol |
| Exact Mass | 523.03 |
| IUPAC Name | N-[[6-bromo-2-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methyl]-2-(2-methoxyphenyl)ethanamine |
| SMILES | COc1ccccc1CCNCc1c(Br)ccc(OC)c1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C24H24BrCl2NO3/c1-29-22-6-4-3-5-17(22)11-12-28-14-18-19(25)8-10-23(30-2)24(18)31-15-16-7-9-20(26)21(27)13-16/h3-10,13,28H,11-12,14-15H2,1-2H3 |
| InChIKey | CXAXTKKQVAJVRZ-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.27 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|