C20H24BrCl2NO2 — CID 66536990
N-[[6-bromo-2-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methyl]pentan-1-amine (PubChem CID 66536990) has the molecular formula C20H24BrCl2NO2 and a molecular weight of 461.23 g/mol. Its IUPAC name is N-[[6-bromo-2-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methyl]pentan-1-amine.
| Compound Name | N-[[6-bromo-2-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methyl]pentan-1-amine |
|---|---|
| PubChem CID | 66536990 |
| Molecular Formula | C20H24BrCl2NO2 |
| Molecular Weight | 461.23 g/mol |
| Exact Mass | 459.04 |
| IUPAC Name | N-[[6-bromo-2-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methyl]pentan-1-amine |
| SMILES | CCCCCNCc1c(Br)ccc(OC)c1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C20H24BrCl2NO2/c1-3-4-5-10-24-12-15-16(21)7-9-19(25-2)20(15)26-13-14-6-8-17(22)18(23)11-14/h6-9,11,24H,3-5,10,12-13H2,1-2H3 |
| InChIKey | FKMOKXAOBDTNQX-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.23 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|