C23H30BrClFNO2 — CID 66536578
N-[[6-bromo-2-[(2-chloro-4-fluorophenyl)methoxy]-3-methoxyphenyl]methyl]octan-1-amine (PubChem CID 66536578) has the molecular formula C23H30BrClFNO2 and a molecular weight of 486.85 g/mol. Its IUPAC name is N-[[6-bromo-2-[(2-chloro-4-fluorophenyl)methoxy]-3-methoxyphenyl]methyl]octan-1-amine.
| Compound Name | N-[[6-bromo-2-[(2-chloro-4-fluorophenyl)methoxy]-3-methoxyphenyl]methyl]octan-1-amine |
|---|---|
| PubChem CID | 66536578 |
| Molecular Formula | C23H30BrClFNO2 |
| Molecular Weight | 486.85 g/mol |
| Exact Mass | 485.11 |
| IUPAC Name | N-[[6-bromo-2-[(2-chloro-4-fluorophenyl)methoxy]-3-methoxyphenyl]methyl]octan-1-amine |
| SMILES | CCCCCCCCNCc1c(Br)ccc(OC)c1OCc1ccc(F)cc1Cl |
| InChI | InChI=1S/C23H30BrClFNO2/c1-3-4-5-6-7-8-13-27-15-19-20(24)11-12-22(28-2)23(19)29-16-17-9-10-18(26)14-21(17)25/h9-12,14,27H,3-8,13,15-16H2,1-2H3 |
| InChIKey | HFWXHMWQFMUTEI-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.85 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|