C18H18BrClFNO2 — CID 66536519
N-[[6-bromo-2-[(2-chloro-4-fluorophenyl)methoxy]-3-methoxyphenyl]methyl]prop-2-en-1-amine (PubChem CID 66536519) has the molecular formula C18H18BrClFNO2 and a molecular weight of 414.70 g/mol. Its IUPAC name is N-[[6-bromo-2-[(2-chloro-4-fluorophenyl)methoxy]-3-methoxyphenyl]methyl]prop-2-en-1-amine.
| Compound Name | N-[[6-bromo-2-[(2-chloro-4-fluorophenyl)methoxy]-3-methoxyphenyl]methyl]prop-2-en-1-amine |
|---|---|
| PubChem CID | 66536519 |
| Molecular Formula | C18H18BrClFNO2 |
| Molecular Weight | 414.70 g/mol |
| Exact Mass | 413.02 |
| IUPAC Name | N-[[6-bromo-2-[(2-chloro-4-fluorophenyl)methoxy]-3-methoxyphenyl]methyl]prop-2-en-1-amine |
| SMILES | C=CCNCc1c(Br)ccc(OC)c1OCc1ccc(F)cc1Cl |
| InChI | InChI=1S/C18H18BrClFNO2/c1-3-8-22-10-14-15(19)6-7-17(23-2)18(14)24-11-12-4-5-13(21)9-16(12)20/h3-7,9,22H,1,8,10-11H2,2H3 |
| InChIKey | IXAJJWHBVQYMGL-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.70 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|