C18H20Cl2FNO2 — CID 17056749
N-[[2-[(2-chloro-4-fluorophenyl)methoxy]-3-methoxyphenyl]methyl]prop-2-en-1-amine;hydrochloride (PubChem CID 17056749) has the molecular formula C18H20Cl2FNO2 and a molecular weight of 372.27 g/mol. Its IUPAC name is N-[[2-[(2-chloro-4-fluorophenyl)methoxy]-3-methoxyphenyl]methyl]prop-2-en-1-amine;hydrochloride.
| Compound Name | N-[[2-[(2-chloro-4-fluorophenyl)methoxy]-3-methoxyphenyl]methyl]prop-2-en-1-amine;hydrochloride |
|---|---|
| PubChem CID | 17056749 |
| Molecular Formula | C18H20Cl2FNO2 |
| Molecular Weight | 372.27 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | N-[[2-[(2-chloro-4-fluorophenyl)methoxy]-3-methoxyphenyl]methyl]prop-2-en-1-amine;hydrochloride |
| SMILES | C=CCNCc1cccc(OC)c1OCc1ccc(F)cc1Cl.Cl |
| InChI | InChI=1S/C18H19ClFNO2.ClH/c1-3-9-21-11-13-5-4-6-17(22-2)18(13)23-12-14-7-8-15(20)10-16(14)19;/h3-8,10,21H,1,9,11-12H2,2H3;1H |
| InChIKey | BBYLYIPFHUMXQE-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.27 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|