C25H24BrClN2O2 — CID 66536052
N-[[6-bromo-2-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methyl]-2-(1H-indol-3-yl)ethanamine (PubChem CID 66536052) has the molecular formula C25H24BrClN2O2 and a molecular weight of 499.84 g/mol. Its IUPAC name is N-[[6-bromo-2-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methyl]-2-(1H-indol-3-yl)ethanamine.
| Compound Name | N-[[6-bromo-2-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methyl]-2-(1H-indol-3-yl)ethanamine |
|---|---|
| PubChem CID | 66536052 |
| Molecular Formula | C25H24BrClN2O2 |
| Molecular Weight | 499.84 g/mol |
| Exact Mass | 498.07 |
| IUPAC Name | N-[[6-bromo-2-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methyl]-2-(1H-indol-3-yl)ethanamine |
| SMILES | COc1ccc(Br)c(CNCCc2c[nH]c3ccccc23)c1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H24BrClN2O2/c1-30-24-11-10-22(26)21(25(24)31-16-17-6-8-19(27)9-7-17)15-28-13-12-18-14-29-23-5-3-2-4-20(18)23/h2-11,14,28-29H,12-13,15-16H2,1H3 |
| InChIKey | YTNWQZJASUHZMA-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 46.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.84 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|