C24H23BrCl2N2O — CID 17295064
N-[[5-bromo-2-[(4-chlorophenyl)methoxy]phenyl]methyl]-2-(1H-indol-3-yl)ethanamine;hydrochloride (PubChem CID 17295064) has the molecular formula C24H23BrCl2N2O and a molecular weight of 506.27 g/mol. Its IUPAC name is N-[[5-bromo-2-[(4-chlorophenyl)methoxy]phenyl]methyl]-2-(1H-indol-3-yl)ethanamine;hydrochloride.
| Compound Name | N-[[5-bromo-2-[(4-chlorophenyl)methoxy]phenyl]methyl]-2-(1H-indol-3-yl)ethanamine;hydrochloride |
|---|---|
| PubChem CID | 17295064 |
| Molecular Formula | C24H23BrCl2N2O |
| Molecular Weight | 506.27 g/mol |
| Exact Mass | 504.04 |
| IUPAC Name | N-[[5-bromo-2-[(4-chlorophenyl)methoxy]phenyl]methyl]-2-(1H-indol-3-yl)ethanamine;hydrochloride |
| SMILES | Cl.Clc1ccc(COc2ccc(Br)cc2CNCCc2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C24H22BrClN2O.ClH/c25-20-7-10-24(29-16-17-5-8-21(26)9-6-17)19(13-20)14-27-12-11-18-15-28-23-4-2-1-3-22(18)23;/h1-10,13,15,27-28H,11-12,14,16H2;1H |
| InChIKey | YDJHSJLGZREURH-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 37.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.27 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|