C24H24Cl2N2O — CID 17295450
N-[(5-chloro-2-phenylmethoxyphenyl)methyl]-2-(1H-indol-3-yl)ethanamine;hydrochloride (PubChem CID 17295450) has the molecular formula C24H24Cl2N2O and a molecular weight of 427.38 g/mol. Its IUPAC name is N-[(5-chloro-2-phenylmethoxyphenyl)methyl]-2-(1H-indol-3-yl)ethanamine;hydrochloride.
| Compound Name | N-[(5-chloro-2-phenylmethoxyphenyl)methyl]-2-(1H-indol-3-yl)ethanamine;hydrochloride |
|---|---|
| PubChem CID | 17295450 |
| Molecular Formula | C24H24Cl2N2O |
| Molecular Weight | 427.38 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | N-[(5-chloro-2-phenylmethoxyphenyl)methyl]-2-(1H-indol-3-yl)ethanamine;hydrochloride |
| SMILES | Cl.Clc1ccc(OCc2ccccc2)c(CNCCc2c[nH]c3ccccc23)c1 |
| InChI | InChI=1S/C24H23ClN2O.ClH/c25-21-10-11-24(28-17-18-6-2-1-3-7-18)20(14-21)15-26-13-12-19-16-27-23-9-5-4-8-22(19)23;/h1-11,14,16,26-27H,12-13,15,17H2;1H |
| InChIKey | BIHHAHWDBLOVIX-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 37.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.38 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|