C18H23ClN2O — CID 4720934
N'-[(5-chloro-2-phenylmethoxyphenyl)methyl]-N-methylpropane-1,3-diamine (PubChem CID 4720934) has the molecular formula C18H23ClN2O and a molecular weight of 318.85 g/mol. Its IUPAC name is N'-[(5-chloro-2-phenylmethoxyphenyl)methyl]-N-methylpropane-1,3-diamine.
| Compound Name | N'-[(5-chloro-2-phenylmethoxyphenyl)methyl]-N-methylpropane-1,3-diamine |
|---|---|
| PubChem CID | 4720934 |
| Molecular Formula | C18H23ClN2O |
| Molecular Weight | 318.85 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | N'-[(5-chloro-2-phenylmethoxyphenyl)methyl]-N-methylpropane-1,3-diamine |
| SMILES | CNCCCNCc1cc(Cl)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C18H23ClN2O/c1-20-10-5-11-21-13-16-12-17(19)8-9-18(16)22-14-15-6-3-2-4-7-15/h2-4,6-9,12,20-21H,5,10-11,13-14H2,1H3 |
| InChIKey | VENZVVXHHNXAJJ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.85 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|