C20H26Cl2FNO — CID 17291134
N-[[5-chloro-2-[(4-fluorophenyl)methoxy]phenyl]methyl]hexan-1-amine;hydrochloride (PubChem CID 17291134) has the molecular formula C20H26Cl2FNO and a molecular weight of 386.34 g/mol. Its IUPAC name is N-[[5-chloro-2-[(4-fluorophenyl)methoxy]phenyl]methyl]hexan-1-amine;hydrochloride.
| Compound Name | N-[[5-chloro-2-[(4-fluorophenyl)methoxy]phenyl]methyl]hexan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 17291134 |
| Molecular Formula | C20H26Cl2FNO |
| Molecular Weight | 386.34 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | N-[[5-chloro-2-[(4-fluorophenyl)methoxy]phenyl]methyl]hexan-1-amine;hydrochloride |
| SMILES | CCCCCCNCc1cc(Cl)ccc1OCc1ccc(F)cc1.Cl |
| InChI | InChI=1S/C20H25ClFNO.ClH/c1-2-3-4-5-12-23-14-17-13-18(21)8-11-20(17)24-15-16-6-9-19(22)10-7-16;/h6-11,13,23H,2-5,12,14-15H2,1H3;1H |
| InChIKey | DBOHCGWMERVIGK-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.34 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|