C16H18Cl2FNO — CID 17290821
N-[[5-chloro-2-[(4-fluorophenyl)methoxy]phenyl]methyl]ethanamine;hydrochloride (PubChem CID 17290821) has the molecular formula C16H18Cl2FNO and a molecular weight of 330.23 g/mol. Its IUPAC name is N-[[5-chloro-2-[(4-fluorophenyl)methoxy]phenyl]methyl]ethanamine;hydrochloride.
| Compound Name | N-[[5-chloro-2-[(4-fluorophenyl)methoxy]phenyl]methyl]ethanamine;hydrochloride |
|---|---|
| PubChem CID | 17290821 |
| Molecular Formula | C16H18Cl2FNO |
| Molecular Weight | 330.23 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | N-[[5-chloro-2-[(4-fluorophenyl)methoxy]phenyl]methyl]ethanamine;hydrochloride |
| SMILES | CCNCc1cc(Cl)ccc1OCc1ccc(F)cc1.Cl |
| InChI | InChI=1S/C16H17ClFNO.ClH/c1-2-19-10-13-9-14(17)5-8-16(13)20-11-12-3-6-15(18)7-4-12;/h3-9,19H,2,10-11H2,1H3;1H |
| InChIKey | HDBYQYGQIGRAKZ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.23 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |