C18H21BrCl2N2O — CID 4720637
N'-[[5-bromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methyl]-N-methylpropane-1,3-diamine (PubChem CID 4720637) has the molecular formula C18H21BrCl2N2O and a molecular weight of 432.19 g/mol. Its IUPAC name is N'-[[5-bromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methyl]-N-methylpropane-1,3-diamine.
| Compound Name | N'-[[5-bromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methyl]-N-methylpropane-1,3-diamine |
|---|---|
| PubChem CID | 4720637 |
| Molecular Formula | C18H21BrCl2N2O |
| Molecular Weight | 432.19 g/mol |
| Exact Mass | 430.02 |
| IUPAC Name | N'-[[5-bromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methyl]-N-methylpropane-1,3-diamine |
| SMILES | CNCCCNCc1cc(Br)ccc1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H21BrCl2N2O/c1-22-7-2-8-23-11-14-9-15(19)4-6-18(14)24-12-13-3-5-16(20)10-17(13)21/h3-6,9-10,22-23H,2,7-8,11-12H2,1H3 |
| InChIKey | ZEVWYNUAKBSKKQ-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.19 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|